C17H31N3O — CID 116726577
1-(1-cyclohexylpyrazol-3-yl)-3-ethoxy-N,3-dimethylbutan-2-amine (PubChem CID 116726577) has the molecular formula C17H31N3O and a molecular weight of 293.46 g/mol. Its IUPAC name is 1-(1-cyclohexylpyrazol-3-yl)-3-ethoxy-N,3-dimethylbutan-2-amine.
| Compound Name | 1-(1-cyclohexylpyrazol-3-yl)-3-ethoxy-N,3-dimethylbutan-2-amine |
|---|---|
| PubChem CID | 116726577 |
| Molecular Formula | C17H31N3O |
| Molecular Weight | 293.46 g/mol |
| Exact Mass | 293.25 |
| IUPAC Name | 1-(1-cyclohexylpyrazol-3-yl)-3-ethoxy-N,3-dimethylbutan-2-amine |
| SMILES | CCOC(C)(C)C(Cc1ccn(C2CCCCC2)n1)NC |
| InChI | InChI=1S/C17H31N3O/c1-5-21-17(2,3)16(18-4)13-14-11-12-20(19-14)15-9-7-6-8-10-15/h11-12,15-16,18H,5-10,13H2,1-4H3 |
| InChIKey | KYXQCEUKQMGVLV-UHFFFAOYSA-N |
| XLogP | 3.33 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 293.46 |
| LogP ≤ 5 | 3.33 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |