C15H29N3O — CID 116726711
3-ethoxy-N-ethyl-1-(3-ethyl-1-methylpyrazol-5-yl)-3-methylbutan-2-amine (PubChem CID 116726711) has the molecular formula C15H29N3O and a molecular weight of 267.42 g/mol. Its IUPAC name is 3-ethoxy-N-ethyl-1-(3-ethyl-1-methylpyrazol-5-yl)-3-methylbutan-2-amine.
| Compound Name | 3-ethoxy-N-ethyl-1-(3-ethyl-1-methylpyrazol-5-yl)-3-methylbutan-2-amine |
|---|---|
| PubChem CID | 116726711 |
| Molecular Formula | C15H29N3O |
| Molecular Weight | 267.42 g/mol |
| Exact Mass | 267.23 |
| IUPAC Name | 3-ethoxy-N-ethyl-1-(3-ethyl-1-methylpyrazol-5-yl)-3-methylbutan-2-amine |
| SMILES | CCNC(Cc1cc(CC)nn1C)C(C)(C)OCC |
| InChI | InChI=1S/C15H29N3O/c1-7-12-10-13(18(6)17-12)11-14(16-8-2)15(4,5)19-9-3/h10,14,16H,7-9,11H2,1-6H3 |
| InChIKey | UNMRTRINYNKIDA-UHFFFAOYSA-N |
| XLogP | 2.32 |
| TPSA | 39.08 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 267.42 |
| LogP ≤ 5 | 2.32 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |