About (2R,3S)-octane-2,3-diol
(2R,3S)-octane-2,3-diol (PubChem CID 11672685) has the molecular formula C8H18O2
and a molecular weight of 146.23 g/mol. Its IUPAC name is (2R,3S)-octane-2,3-diol.
Molecular Properties
| Compound Name | (2R,3S)-octane-2,3-diol |
| PubChem CID | 11672685 |
| Molecular Formula | C8H18O2 |
| Molecular Weight | 146.23 g/mol |
| Exact Mass | 146.13 |
| IUPAC Name | (2R,3S)-octane-2,3-diol |
| SMILES | CCCCC[C@H](O)[C@@H](C)O |
| InChI | InChI=1S/C8H18O2/c1-3-4-5-6-8(10)7(2)9/h7-10H,3-6H2,1-2H3/t7-,8+/m1/s1 |
| InChIKey | XMTUJCWABCYSIV-SFYZADRCSA-N |
| XLogP | 1.31 |
| TPSA | 40.46 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 10 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 146.23 |
| LogP ≤ 5 | 1.31 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze (2R,3S)-octane-2,3-diol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of (2R,3S)-octane-2,3-diol?
The IUPAC name of (2R,3S)-octane-2,3-diol (CID 11672685) is (2R,3S)-octane-2,3-diol.
What is the SMILES notation for (2R,3S)-octane-2,3-diol?
The canonical SMILES for (2R,3S)-octane-2,3-diol is CCCCC[C@H](O)[C@@H](C)O.
What is the InChIKey of (2R,3S)-octane-2,3-diol?
The InChIKey is XMTUJCWABCYSIV-SFYZADRCSA-N. The full InChI is InChI=1S/C8H18O2/c1-3-4-5-6-8(10)7(2)9/h7-10H,3-6H2,1-2H3/t7-,8+/m1/s1.
What are the key properties of (2R,3S)-octane-2,3-diol?
(2R,3S)-octane-2,3-diol has a molecular weight of 146.23 g/mol, XLogP of 1.31, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for (2R,3S)-octane-2,3-diol is sourced from PubChem (CID 11672685), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).