About ethyl 3-acetamidobutanoate
ethyl 3-acetamidobutanoate (PubChem CID 11672745) has the molecular formula C8H15NO3
and a molecular weight of 173.21 g/mol. Its IUPAC name is ethyl 3-acetamidobutanoate.
Molecular Properties
| Compound Name | ethyl 3-acetamidobutanoate |
| PubChem CID | 11672745 |
| Molecular Formula | C8H15NO3 |
| Molecular Weight | 173.21 g/mol |
| Exact Mass | 173.11 |
| IUPAC Name | ethyl 3-acetamidobutanoate |
| SMILES | CCOC(=O)CC(C)NC(C)=O |
| InChI | InChI=1S/C8H15NO3/c1-4-12-8(11)5-6(2)9-7(3)10/h6H,4-5H2,1-3H3,(H,9,10) |
| InChIKey | JQGFASTXESCOHX-UHFFFAOYSA-N |
| XLogP | 0.46 |
| TPSA | 55.40 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 12 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 173.21 |
| LogP ≤ 5 | 0.46 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
Analyze ethyl 3-acetamidobutanoate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of ethyl 3-acetamidobutanoate?
The IUPAC name of ethyl 3-acetamidobutanoate (CID 11672745) is ethyl 3-acetamidobutanoate.
What is the SMILES notation for ethyl 3-acetamidobutanoate?
The canonical SMILES for ethyl 3-acetamidobutanoate is CCOC(=O)CC(C)NC(C)=O.
What is the InChIKey of ethyl 3-acetamidobutanoate?
The InChIKey is JQGFASTXESCOHX-UHFFFAOYSA-N. The full InChI is InChI=1S/C8H15NO3/c1-4-12-8(11)5-6(2)9-7(3)10/h6H,4-5H2,1-3H3,(H,9,10).
What are the key properties of ethyl 3-acetamidobutanoate?
ethyl 3-acetamidobutanoate has a molecular weight of 173.21 g/mol, XLogP of 0.46, 4 rotatable bonds, 1 hydrogen bond donors, and 3 hydrogen bond acceptors.
Where does this data come from?
All data for ethyl 3-acetamidobutanoate is sourced from PubChem (CID 11672745), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).