About 5-(1H-imidazol-5-yl)-N,N-dimethylpentan-1-amine
5-(1H-imidazol-5-yl)-N,N-dimethylpentan-1-amine (PubChem CID 11672774) has the molecular formula C10H19N3
and a molecular weight of 181.28 g/mol. Its IUPAC name is 5-(1H-imidazol-5-yl)-N,N-dimethylpentan-1-amine.
Molecular Properties
| Compound Name | 5-(1H-imidazol-5-yl)-N,N-dimethylpentan-1-amine |
| PubChem CID | 11672774 |
| Molecular Formula | C10H19N3 |
| Molecular Weight | 181.28 g/mol |
| Exact Mass | 181.16 |
| IUPAC Name | 5-(1H-imidazol-5-yl)-N,N-dimethylpentan-1-amine |
| SMILES | CN(C)CCCCCc1cnc[nH]1 |
| InChI | InChI=1S/C10H19N3/c1-13(2)7-5-3-4-6-10-8-11-9-12-10/h8-9H,3-7H2,1-2H3,(H,11,12) |
| InChIKey | MVHBNHUOEFGIBK-UHFFFAOYSA-N |
| XLogP | 1.68 |
| TPSA | 31.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 181.28 |
| LogP ≤ 5 | 1.68 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'} |
|---|
Analyze 5-(1H-imidazol-5-yl)-N,N-dimethylpentan-1-amine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 5-(1H-imidazol-5-yl)-N,N-dimethylpentan-1-amine?
The IUPAC name of 5-(1H-imidazol-5-yl)-N,N-dimethylpentan-1-amine (CID 11672774) is 5-(1H-imidazol-5-yl)-N,N-dimethylpentan-1-amine.
What is the SMILES notation for 5-(1H-imidazol-5-yl)-N,N-dimethylpentan-1-amine?
The canonical SMILES for 5-(1H-imidazol-5-yl)-N,N-dimethylpentan-1-amine is CN(C)CCCCCc1cnc[nH]1.
What is the InChIKey of 5-(1H-imidazol-5-yl)-N,N-dimethylpentan-1-amine?
The InChIKey is MVHBNHUOEFGIBK-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H19N3/c1-13(2)7-5-3-4-6-10-8-11-9-12-10/h8-9H,3-7H2,1-2H3,(H,11,12).
What are the key properties of 5-(1H-imidazol-5-yl)-N,N-dimethylpentan-1-amine?
5-(1H-imidazol-5-yl)-N,N-dimethylpentan-1-amine has a molecular weight of 181.28 g/mol, XLogP of 1.68, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 5-(1H-imidazol-5-yl)-N,N-dimethylpentan-1-amine is sourced from PubChem (CID 11672774), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).