C8H12O3S — CID 11672814
(1S,2R,5R,7R)-9,9-dimethyl-6,8,10-trioxa-3-thiatricyclo[5.3.0.02,5]decane (PubChem CID 11672814) has the molecular formula C8H12O3S and a molecular weight of 188.25 g/mol. Its IUPAC name is (1S,2R,5R,7R)-9,9-dimethyl-6,8,10-trioxa-3-thiatricyclo[5.3.0.02,5]decane.
| Compound Name | (1S,2R,5R,7R)-9,9-dimethyl-6,8,10-trioxa-3-thiatricyclo[5.3.0.02,5]decane |
|---|---|
| PubChem CID | 11672814 |
| Molecular Formula | C8H12O3S |
| Molecular Weight | 188.25 g/mol |
| Exact Mass | 188.05 |
| IUPAC Name | (1S,2R,5R,7R)-9,9-dimethyl-6,8,10-trioxa-3-thiatricyclo[5.3.0.02,5]decane |
| SMILES | CC1(C)O[C@H]2O[C@@H]3CS[C@@H]3[C@H]2O1 |
| InChI | InChI=1S/C8H12O3S/c1-8(2)10-5-6-4(3-12-6)9-7(5)11-8/h4-7H,3H2,1-2H3/t4-,5-,6+,7-/m1/s1 |
| InChIKey | KBPBNVWMLFGSDR-MVIOUDGNSA-N |
| XLogP | 0.98 |
| TPSA | 27.69 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 12 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 188.25 |
| LogP ≤ 5 | 0.98 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |