C12H22N2OS — CID 116730707
[2-(1-ethoxybutyl)-4-ethyl-1,3-thiazol-5-yl]methanamine (PubChem CID 116730707) has the molecular formula C12H22N2OS and a molecular weight of 242.39 g/mol. Its IUPAC name is [2-(1-ethoxybutyl)-4-ethyl-1,3-thiazol-5-yl]methanamine.
| Compound Name | [2-(1-ethoxybutyl)-4-ethyl-1,3-thiazol-5-yl]methanamine |
|---|---|
| PubChem CID | 116730707 |
| Molecular Formula | C12H22N2OS |
| Molecular Weight | 242.39 g/mol |
| Exact Mass | 242.15 |
| IUPAC Name | [2-(1-ethoxybutyl)-4-ethyl-1,3-thiazol-5-yl]methanamine |
| SMILES | CCCC(OCC)c1nc(CC)c(CN)s1 |
| InChI | InChI=1S/C12H22N2OS/c1-4-7-10(15-6-3)12-14-9(5-2)11(8-13)16-12/h10H,4-8,13H2,1-3H3 |
| InChIKey | NRAWLYRTXPPMKQ-UHFFFAOYSA-N |
| XLogP | 3.04 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.39 |
| LogP ≤ 5 | 3.04 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |