About CID 11673102
CID 11673102 (PubChem CID 11673102) has the molecular formula C13H14O4
and a molecular weight of 234.25 g/mol.
Molecular Properties
| Compound Name | CID 11673102 |
| PubChem CID | 11673102 |
| Molecular Formula | C13H14O4 |
| Molecular Weight | 234.25 g/mol |
| Exact Mass | 234.09 |
| IUPAC Name | — |
| SMILES | c1ccc2c(c1)CC1(OCCO1)C21OCCO1 |
| InChI | InChI=1S/C13H14O4/c1-2-4-11-10(3-1)9-12(14-5-6-15-12)13(11)16-7-8-17-13/h1-4H,5-9H2 |
| InChIKey | FCTKRVWMVMIBFG-UHFFFAOYSA-N |
| XLogP | 1.19 |
| TPSA | 36.92 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 234.25 |
| LogP ≤ 5 | 1.19 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |
Analyze CID 11673102 with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of CID 11673102?
The IUPAC name of CID 11673102 (CID 11673102) is not available.
What is the SMILES notation for CID 11673102?
The canonical SMILES for CID 11673102 is c1ccc2c(c1)CC1(OCCO1)C21OCCO1.
What is the InChIKey of CID 11673102?
The InChIKey is FCTKRVWMVMIBFG-UHFFFAOYSA-N. The full InChI is InChI=1S/C13H14O4/c1-2-4-11-10(3-1)9-12(14-5-6-15-12)13(11)16-7-8-17-13/h1-4H,5-9H2.
What are the key properties of CID 11673102?
CID 11673102 has a molecular weight of 234.25 g/mol, XLogP of 1.19, 0 rotatable bonds, 0 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for CID 11673102 is sourced from PubChem (CID 11673102), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).