About 1,3-diethyl-N-phenyl-4,5-dihydroimidazol-1-ium-2-carbothioamide
1,3-diethyl-N-phenyl-4,5-dihydroimidazol-1-ium-2-carbothioamide (PubChem CID 11673348) has the molecular formula C14H20N3S+
and a molecular weight of 262.40 g/mol. Its IUPAC name is 1,3-diethyl-N-phenyl-4,5-dihydroimidazol-1-ium-2-carbothioamide.
Molecular Properties
| Compound Name | 1,3-diethyl-N-phenyl-4,5-dihydroimidazol-1-ium-2-carbothioamide |
| PubChem CID | 11673348 |
| Molecular Formula | C14H20N3S+ |
| Molecular Weight | 262.40 g/mol |
| Exact Mass | 262.14 |
| IUPAC Name | 1,3-diethyl-N-phenyl-4,5-dihydroimidazol-1-ium-2-carbothioamide |
| SMILES | CCN1CC[N+](CC)=C1C(=S)Nc1ccccc1 |
| InChI | InChI=1S/C14H19N3S/c1-3-16-10-11-17(4-2)14(16)13(18)15-12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3/p+1 |
| InChIKey | KCVRGAGYLABGRL-UHFFFAOYSA-O |
| XLogP | 2.19 |
| TPSA | 18.28 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 262.40 |
| LogP ≤ 5 | 2.19 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'quaternary_nitrogen_1', 'substructure': 'N/A'}, {'alert_name': 'Thiocarbonyl_group', 'substructure': 'N/A'} |
|---|
Analyze 1,3-diethyl-N-phenyl-4,5-dihydroimidazol-1-ium-2-carbothioamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1,3-diethyl-N-phenyl-4,5-dihydroimidazol-1-ium-2-carbothioamide?
The IUPAC name of 1,3-diethyl-N-phenyl-4,5-dihydroimidazol-1-ium-2-carbothioamide (CID 11673348) is 1,3-diethyl-N-phenyl-4,5-dihydroimidazol-1-ium-2-carbothioamide.
What is the SMILES notation for 1,3-diethyl-N-phenyl-4,5-dihydroimidazol-1-ium-2-carbothioamide?
The canonical SMILES for 1,3-diethyl-N-phenyl-4,5-dihydroimidazol-1-ium-2-carbothioamide is CCN1CC[N+](CC)=C1C(=S)Nc1ccccc1.
What is the InChIKey of 1,3-diethyl-N-phenyl-4,5-dihydroimidazol-1-ium-2-carbothioamide?
The InChIKey is KCVRGAGYLABGRL-UHFFFAOYSA-O. The full InChI is InChI=1S/C14H19N3S/c1-3-16-10-11-17(4-2)14(16)13(18)15-12-8-6-5-7-9-12/h5-9H,3-4,10-11H2,1-2H3/p+1.
What are the key properties of 1,3-diethyl-N-phenyl-4,5-dihydroimidazol-1-ium-2-carbothioamide?
1,3-diethyl-N-phenyl-4,5-dihydroimidazol-1-ium-2-carbothioamide has a molecular weight of 262.40 g/mol, XLogP of 2.19, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1,3-diethyl-N-phenyl-4,5-dihydroimidazol-1-ium-2-carbothioamide is sourced from PubChem (CID 11673348), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).