C9H16N4O — CID 116734001
4-(1-methoxybutyl)-6-methyl-1,3,5-triazin-2-amine (PubChem CID 116734001) has the molecular formula C9H16N4O and a molecular weight of 196.25 g/mol. Its IUPAC name is 4-(1-methoxybutyl)-6-methyl-1,3,5-triazin-2-amine.
| Compound Name | 4-(1-methoxybutyl)-6-methyl-1,3,5-triazin-2-amine |
|---|---|
| PubChem CID | 116734001 |
| Molecular Formula | C9H16N4O |
| Molecular Weight | 196.25 g/mol |
| Exact Mass | 196.13 |
| IUPAC Name | 4-(1-methoxybutyl)-6-methyl-1,3,5-triazin-2-amine |
| SMILES | CCCC(OC)c1nc(C)nc(N)n1 |
| InChI | InChI=1S/C9H16N4O/c1-4-5-7(14-3)8-11-6(2)12-9(10)13-8/h7H,4-5H2,1-3H3,(H2,10,11,12,13) |
| InChIKey | SMXBHCGUKWYULV-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 73.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 196.25 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |