C9H12N2O2 — CID 116734128
2-(1-methoxycyclobutyl)-1H-imidazole-5-carbaldehyde (PubChem CID 116734128) has the molecular formula C9H12N2O2 and a molecular weight of 180.21 g/mol. Its IUPAC name is 2-(1-methoxycyclobutyl)-1H-imidazole-5-carbaldehyde.
| Compound Name | 2-(1-methoxycyclobutyl)-1H-imidazole-5-carbaldehyde |
|---|---|
| PubChem CID | 116734128 |
| Molecular Formula | C9H12N2O2 |
| Molecular Weight | 180.21 g/mol |
| Exact Mass | 180.09 |
| IUPAC Name | 2-(1-methoxycyclobutyl)-1H-imidazole-5-carbaldehyde |
| SMILES | COC1(c2ncc(C=O)[nH]2)CCC1 |
| InChI | InChI=1S/C9H12N2O2/c1-13-9(3-2-4-9)8-10-5-7(6-12)11-8/h5-6H,2-4H2,1H3,(H,10,11) |
| InChIKey | FXAVVBUXDJFXTI-UHFFFAOYSA-N |
| XLogP | 1.25 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 13 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 180.21 |
| LogP ≤ 5 | 1.25 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|