C9H12N4O — CID 116734138
4-amino-2-(1-methoxypropyl)pyrimidine-5-carbonitrile (PubChem CID 116734138) has the molecular formula C9H12N4O and a molecular weight of 192.22 g/mol. Its IUPAC name is 4-amino-2-(1-methoxypropyl)pyrimidine-5-carbonitrile.
| Compound Name | 4-amino-2-(1-methoxypropyl)pyrimidine-5-carbonitrile |
|---|---|
| PubChem CID | 116734138 |
| Molecular Formula | C9H12N4O |
| Molecular Weight | 192.22 g/mol |
| Exact Mass | 192.10 |
| IUPAC Name | 4-amino-2-(1-methoxypropyl)pyrimidine-5-carbonitrile |
| SMILES | CCC(OC)c1ncc(C#N)c(N)n1 |
| InChI | InChI=1S/C9H12N4O/c1-3-7(14-2)9-12-5-6(4-10)8(11)13-9/h5,7H,3H2,1-2H3,(H2,11,12,13) |
| InChIKey | WTLYGSAUVFIRLL-UHFFFAOYSA-N |
| XLogP | 1.03 |
| TPSA | 84.82 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 14 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 192.22 |
| LogP ≤ 5 | 1.03 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |