C15H26O4 — CID 11673436
ethyl 2-[(4S,4aS,5R,8aS)-2,2,4-trimethyl-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxin-5-yl]acetate (PubChem CID 11673436) has the molecular formula C15H26O4 and a molecular weight of 270.37 g/mol. Its IUPAC name is ethyl 2-[(4S,4aS,5R,8aS)-2,2,4-trimethyl-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxin-5-yl]acetate.
| Compound Name | ethyl 2-[(4S,4aS,5R,8aS)-2,2,4-trimethyl-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxin-5-yl]acetate |
|---|---|
| PubChem CID | 11673436 |
| Molecular Formula | C15H26O4 |
| Molecular Weight | 270.37 g/mol |
| Exact Mass | 270.18 |
| IUPAC Name | ethyl 2-[(4S,4aS,5R,8aS)-2,2,4-trimethyl-4a,5,6,7,8,8a-hexahydro-4H-benzo[d][1,3]dioxin-5-yl]acetate |
| SMILES | CCOC(=O)C[C@H]1CCC[C@@H]2OC(C)(C)O[C@@H](C)[C@H]12 |
| InChI | InChI=1S/C15H26O4/c1-5-17-13(16)9-11-7-6-8-12-14(11)10(2)18-15(3,4)19-12/h10-12,14H,5-9H2,1-4H3/t10-,11+,12-,14+/m0/s1 |
| InChIKey | FELTTZDRVRMJGN-KZVDOYCCSA-N |
| XLogP | 2.90 |
| TPSA | 44.76 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 270.37 |
| LogP ≤ 5 | 2.90 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 4 |