C16H36O2Si — CID 11673678
(2S,4R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylheptan-1-ol (PubChem CID 11673678) has the molecular formula C16H36O2Si and a molecular weight of 288.55 g/mol. Its IUPAC name is (2S,4R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylheptan-1-ol.
| Compound Name | (2S,4R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylheptan-1-ol |
|---|---|
| PubChem CID | 11673678 |
| Molecular Formula | C16H36O2Si |
| Molecular Weight | 288.55 g/mol |
| Exact Mass | 288.25 |
| IUPAC Name | (2S,4R,6R)-7-[tert-butyl(dimethyl)silyl]oxy-2,4,6-trimethylheptan-1-ol |
| SMILES | C[C@H](C[C@H](C)CO)C[C@@H](C)CO[Si](C)(C)C(C)(C)C |
| InChI | InChI=1S/C16H36O2Si/c1-13(9-14(2)11-17)10-15(3)12-18-19(7,8)16(4,5)6/h13-15,17H,9-12H2,1-8H3/t13-,14+,15-/m1/s1 |
| InChIKey | NRQCSMBOQNSJRE-QLFBSQMISA-N |
| XLogP | 4.69 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 288.55 |
| LogP ≤ 5 | 4.69 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
| Structural Alerts | {'alert_name': 'heavy_metal', 'substructure': 'N/A'} |
|---|