C10H15ClN2O3 — CID 116740050
5-(1-chloroethyl)-3-(4-methoxyoxan-4-yl)-1,2,4-oxadiazole (PubChem CID 116740050) has the molecular formula C10H15ClN2O3 and a molecular weight of 246.69 g/mol. Its IUPAC name is 5-(1-chloroethyl)-3-(4-methoxyoxan-4-yl)-1,2,4-oxadiazole.
| Compound Name | 5-(1-chloroethyl)-3-(4-methoxyoxan-4-yl)-1,2,4-oxadiazole |
|---|---|
| PubChem CID | 116740050 |
| Molecular Formula | C10H15ClN2O3 |
| Molecular Weight | 246.69 g/mol |
| Exact Mass | 246.08 |
| IUPAC Name | 5-(1-chloroethyl)-3-(4-methoxyoxan-4-yl)-1,2,4-oxadiazole |
| SMILES | COC1(c2noc(C(C)Cl)n2)CCOCC1 |
| InChI | InChI=1S/C10H15ClN2O3/c1-7(11)8-12-9(13-16-8)10(14-2)3-5-15-6-4-10/h7H,3-6H2,1-2H3 |
| InChIKey | MVLFJLRUJKCMTC-UHFFFAOYSA-N |
| XLogP | 2.02 |
| TPSA | 57.38 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 246.69 |
| LogP ≤ 5 | 2.02 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'} |
|---|