C15H28O5Si — CID 11674102
(3R,4R,5S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-7-methyl-1,6-dioxaspiro[2.5]octane-5-carbaldehyde (PubChem CID 11674102) has the molecular formula C15H28O5Si and a molecular weight of 316.47 g/mol. Its IUPAC name is (3R,4R,5S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-7-methyl-1,6-dioxaspiro[2.5]octane-5-carbaldehyde.
| Compound Name | (3R,4R,5S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-7-methyl-1,6-dioxaspiro[2.5]octane-5-carbaldehyde |
|---|---|
| PubChem CID | 11674102 |
| Molecular Formula | C15H28O5Si |
| Molecular Weight | 316.47 g/mol |
| Exact Mass | 316.17 |
| IUPAC Name | (3R,4R,5S,7S)-4-[tert-butyl(dimethyl)silyl]oxy-7-methoxy-7-methyl-1,6-dioxaspiro[2.5]octane-5-carbaldehyde |
| SMILES | CO[C@]1(C)C[C@@]2(CO2)[C@H](O[Si](C)(C)C(C)(C)C)[C@@H](C=O)O1 |
| InChI | InChI=1S/C15H28O5Si/c1-13(2,3)21(6,7)20-12-11(8-16)19-14(4,17-5)9-15(12)10-18-15/h8,11-12H,9-10H2,1-7H3/t11-,12-,14+,15-/m1/s1 |
| InChIKey | PGUXJCUBSOYISL-RJZRQDKASA-N |
| XLogP | 2.50 |
| TPSA | 57.29 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 316.47 |
| LogP ≤ 5 | 2.50 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'Three-membered_heterocycle', 'substructure': 'N/A'} |
|---|