C10H16N2O4 — CID 116743989
2-[3-(2-ethoxybutan-2-yl)-1,2,4-oxadiazol-5-yl]acetic acid (PubChem CID 116743989) has the molecular formula C10H16N2O4 and a molecular weight of 228.25 g/mol. Its IUPAC name is 2-[3-(2-ethoxybutan-2-yl)-1,2,4-oxadiazol-5-yl]acetic acid.
| Compound Name | 2-[3-(2-ethoxybutan-2-yl)-1,2,4-oxadiazol-5-yl]acetic acid |
|---|---|
| PubChem CID | 116743989 |
| Molecular Formula | C10H16N2O4 |
| Molecular Weight | 228.25 g/mol |
| Exact Mass | 228.11 |
| IUPAC Name | 2-[3-(2-ethoxybutan-2-yl)-1,2,4-oxadiazol-5-yl]acetic acid |
| SMILES | CCOC(C)(CC)c1noc(CC(=O)O)n1 |
| InChI | InChI=1S/C10H16N2O4/c1-4-10(3,15-5-2)9-11-7(16-12-9)6-8(13)14/h4-6H2,1-3H3,(H,13,14) |
| InChIKey | VEWOQZXSPYQNPK-UHFFFAOYSA-N |
| XLogP | 1.36 |
| TPSA | 85.45 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 228.25 |
| LogP ≤ 5 | 1.36 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |