About 3,3-dimethyldeca-1,5-diynoxy-tri(propan-2-yl)silane
3,3-dimethyldeca-1,5-diynoxy-tri(propan-2-yl)silane (PubChem CID 11674419) has the molecular formula C21H38OSi
and a molecular weight of 334.62 g/mol. Its IUPAC name is 3,3-dimethyldeca-1,5-diynoxy-tri(propan-2-yl)silane.
Molecular Properties
| Compound Name | 3,3-dimethyldeca-1,5-diynoxy-tri(propan-2-yl)silane |
| PubChem CID | 11674419 |
| Molecular Formula | C21H38OSi |
| Molecular Weight | 334.62 g/mol |
| Exact Mass | 334.27 |
| IUPAC Name | 3,3-dimethyldeca-1,5-diynoxy-tri(propan-2-yl)silane |
| SMILES | CCCCC#CCC(C)(C)C#CO[Si](C(C)C)(C(C)C)C(C)C |
| InChI | InChI=1S/C21H38OSi/c1-10-11-12-13-14-15-21(8,9)16-17-22-23(18(2)3,19(4)5)20(6)7/h18-20H,10-12,15H2,1-9H3 |
| InChIKey | FZPMDUGMZVSIEU-UHFFFAOYSA-N |
| XLogP | 6.75 |
| TPSA | 9.23 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 334.62 |
| LogP ≤ 5 | 6.75 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Aliphatic_long_chain', 'substructure': 'N/A'}, {'alert_name': 'heavy_metal', 'substructure': 'N/A'}, {'alert_name': 'triple_bond', 'substructure': 'N/A'} |
|---|
Analyze 3,3-dimethyldeca-1,5-diynoxy-tri(propan-2-yl)silane with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 3,3-dimethyldeca-1,5-diynoxy-tri(propan-2-yl)silane?
The IUPAC name of 3,3-dimethyldeca-1,5-diynoxy-tri(propan-2-yl)silane (CID 11674419) is 3,3-dimethyldeca-1,5-diynoxy-tri(propan-2-yl)silane.
What is the SMILES notation for 3,3-dimethyldeca-1,5-diynoxy-tri(propan-2-yl)silane?
The canonical SMILES for 3,3-dimethyldeca-1,5-diynoxy-tri(propan-2-yl)silane is CCCCC#CCC(C)(C)C#CO[Si](C(C)C)(C(C)C)C(C)C.
What is the InChIKey of 3,3-dimethyldeca-1,5-diynoxy-tri(propan-2-yl)silane?
The InChIKey is FZPMDUGMZVSIEU-UHFFFAOYSA-N. The full InChI is InChI=1S/C21H38OSi/c1-10-11-12-13-14-15-21(8,9)16-17-22-23(18(2)3,19(4)5)20(6)7/h18-20H,10-12,15H2,1-9H3.
What are the key properties of 3,3-dimethyldeca-1,5-diynoxy-tri(propan-2-yl)silane?
3,3-dimethyldeca-1,5-diynoxy-tri(propan-2-yl)silane has a molecular weight of 334.62 g/mol, XLogP of 6.75, 7 rotatable bonds, 0 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 3,3-dimethyldeca-1,5-diynoxy-tri(propan-2-yl)silane is sourced from PubChem (CID 11674419), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).