C14H22N2O3 — CID 116745139
5-ethyl-4-hydroxy-2-(1-methoxy-3-methylcyclohexyl)-1H-pyrimidin-6-one (PubChem CID 116745139) has the molecular formula C14H22N2O3 and a molecular weight of 266.34 g/mol. Its IUPAC name is 5-ethyl-4-hydroxy-2-(1-methoxy-3-methylcyclohexyl)-1H-pyrimidin-6-one.
| Compound Name | 5-ethyl-4-hydroxy-2-(1-methoxy-3-methylcyclohexyl)-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 116745139 |
| Molecular Formula | C14H22N2O3 |
| Molecular Weight | 266.34 g/mol |
| Exact Mass | 266.16 |
| IUPAC Name | 5-ethyl-4-hydroxy-2-(1-methoxy-3-methylcyclohexyl)-1H-pyrimidin-6-one |
| SMILES | CCc1c(O)nc(C2(OC)CCCC(C)C2)[nH]c1=O |
| InChI | InChI=1S/C14H22N2O3/c1-4-10-11(17)15-13(16-12(10)18)14(19-3)7-5-6-9(2)8-14/h9H,4-8H2,1-3H3,(H2,15,16,17,18) |
| InChIKey | UGCVUNDRQSFGTA-UHFFFAOYSA-N |
| XLogP | 2.09 |
| TPSA | 75.21 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 266.34 |
| LogP ≤ 5 | 2.09 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |