C13H19IN2O2 — CID 116745495
2-(1-ethoxy-3-methylcyclohexyl)-5-iodo-1H-pyrimidin-6-one (PubChem CID 116745495) has the molecular formula C13H19IN2O2 and a molecular weight of 362.21 g/mol. Its IUPAC name is 2-(1-ethoxy-3-methylcyclohexyl)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 2-(1-ethoxy-3-methylcyclohexyl)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 116745495 |
| Molecular Formula | C13H19IN2O2 |
| Molecular Weight | 362.21 g/mol |
| Exact Mass | 362.05 |
| IUPAC Name | 2-(1-ethoxy-3-methylcyclohexyl)-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCOC1(c2ncc(I)c(=O)[nH]2)CCCC(C)C1 |
| InChI | InChI=1S/C13H19IN2O2/c1-3-18-13(6-4-5-9(2)7-13)12-15-8-10(14)11(17)16-12/h8-9H,3-7H2,1-2H3,(H,15,16,17) |
| InChIKey | IYGYBQKBPAETGA-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 362.21 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|