C14H21IN2O2 — CID 116745510
2-(1-ethoxy-4,4-dimethylcyclohexyl)-5-iodo-1H-pyrimidin-6-one (PubChem CID 116745510) has the molecular formula C14H21IN2O2 and a molecular weight of 376.24 g/mol. Its IUPAC name is 2-(1-ethoxy-4,4-dimethylcyclohexyl)-5-iodo-1H-pyrimidin-6-one.
| Compound Name | 2-(1-ethoxy-4,4-dimethylcyclohexyl)-5-iodo-1H-pyrimidin-6-one |
|---|---|
| PubChem CID | 116745510 |
| Molecular Formula | C14H21IN2O2 |
| Molecular Weight | 376.24 g/mol |
| Exact Mass | 376.06 |
| IUPAC Name | 2-(1-ethoxy-4,4-dimethylcyclohexyl)-5-iodo-1H-pyrimidin-6-one |
| SMILES | CCOC1(c2ncc(I)c(=O)[nH]2)CCC(C)(C)CC1 |
| InChI | InChI=1S/C14H21IN2O2/c1-4-19-14(7-5-13(2,3)6-8-14)12-16-9-10(15)11(18)17-12/h9H,4-8H2,1-3H3,(H,16,17,18) |
| InChIKey | RPMDBUIZXYAOKT-UHFFFAOYSA-N |
| XLogP | 3.21 |
| TPSA | 54.98 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 376.24 |
| LogP ≤ 5 | 3.21 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'iodine', 'substructure': 'N/A'} |
|---|