About [4-[bis(1H-pyrrol-2-yl)methyl]-3,5-dimethylphenyl] 2-chloroacetate
[4-[bis(1H-pyrrol-2-yl)methyl]-3,5-dimethylphenyl] 2-chloroacetate (PubChem CID 11674571) has the molecular formula C19H19ClN2O2
and a molecular weight of 342.83 g/mol. Its IUPAC name is [4-[bis(1H-pyrrol-2-yl)methyl]-3,5-dimethylphenyl] 2-chloroacetate.
Molecular Properties
| Compound Name | [4-[bis(1H-pyrrol-2-yl)methyl]-3,5-dimethylphenyl] 2-chloroacetate |
| PubChem CID | 11674571 |
| Molecular Formula | C19H19ClN2O2 |
| Molecular Weight | 342.83 g/mol |
| Exact Mass | 342.11 |
| IUPAC Name | [4-[bis(1H-pyrrol-2-yl)methyl]-3,5-dimethylphenyl] 2-chloroacetate |
| SMILES | Cc1cc(OC(=O)CCl)cc(C)c1C(c1ccc[nH]1)c1ccc[nH]1 |
| InChI | InChI=1S/C19H19ClN2O2/c1-12-9-14(24-17(23)11-20)10-13(2)18(12)19(15-5-3-7-21-15)16-6-4-8-22-16/h3-10,19,21-22H,11H2,1-2H3 |
| InChIKey | KTDKLURHTLPPOA-UHFFFAOYSA-N |
| XLogP | 4.28 |
| TPSA | 57.88 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 342.83 |
| LogP ≤ 5 | 4.28 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'phenol_ester', 'substructure': 'N/A'} |
|---|
Analyze [4-[bis(1H-pyrrol-2-yl)methyl]-3,5-dimethylphenyl] 2-chloroacetate with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of [4-[bis(1H-pyrrol-2-yl)methyl]-3,5-dimethylphenyl] 2-chloroacetate?
The IUPAC name of [4-[bis(1H-pyrrol-2-yl)methyl]-3,5-dimethylphenyl] 2-chloroacetate (CID 11674571) is [4-[bis(1H-pyrrol-2-yl)methyl]-3,5-dimethylphenyl] 2-chloroacetate.
What is the SMILES notation for [4-[bis(1H-pyrrol-2-yl)methyl]-3,5-dimethylphenyl] 2-chloroacetate?
The canonical SMILES for [4-[bis(1H-pyrrol-2-yl)methyl]-3,5-dimethylphenyl] 2-chloroacetate is Cc1cc(OC(=O)CCl)cc(C)c1C(c1ccc[nH]1)c1ccc[nH]1.
What is the InChIKey of [4-[bis(1H-pyrrol-2-yl)methyl]-3,5-dimethylphenyl] 2-chloroacetate?
The InChIKey is KTDKLURHTLPPOA-UHFFFAOYSA-N. The full InChI is InChI=1S/C19H19ClN2O2/c1-12-9-14(24-17(23)11-20)10-13(2)18(12)19(15-5-3-7-21-15)16-6-4-8-22-16/h3-10,19,21-22H,11H2,1-2H3.
What are the key properties of [4-[bis(1H-pyrrol-2-yl)methyl]-3,5-dimethylphenyl] 2-chloroacetate?
[4-[bis(1H-pyrrol-2-yl)methyl]-3,5-dimethylphenyl] 2-chloroacetate has a molecular weight of 342.83 g/mol, XLogP of 4.28, 5 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for [4-[bis(1H-pyrrol-2-yl)methyl]-3,5-dimethylphenyl] 2-chloroacetate is sourced from PubChem (CID 11674571), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).