C16H25ClN2O — CID 116745747
4-chloro-2-(1-ethoxy-3-methylcyclohexyl)-6-propan-2-ylpyrimidine (PubChem CID 116745747) has the molecular formula C16H25ClN2O and a molecular weight of 296.84 g/mol. Its IUPAC name is 4-chloro-2-(1-ethoxy-3-methylcyclohexyl)-6-propan-2-ylpyrimidine.
| Compound Name | 4-chloro-2-(1-ethoxy-3-methylcyclohexyl)-6-propan-2-ylpyrimidine |
|---|---|
| PubChem CID | 116745747 |
| Molecular Formula | C16H25ClN2O |
| Molecular Weight | 296.84 g/mol |
| Exact Mass | 296.17 |
| IUPAC Name | 4-chloro-2-(1-ethoxy-3-methylcyclohexyl)-6-propan-2-ylpyrimidine |
| SMILES | CCOC1(c2nc(Cl)cc(C(C)C)n2)CCCC(C)C1 |
| InChI | InChI=1S/C16H25ClN2O/c1-5-20-16(8-6-7-12(4)10-16)15-18-13(11(2)3)9-14(17)19-15/h9,11-12H,5-8,10H2,1-4H3 |
| InChIKey | XPHMVUQSQHYTRB-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 296.84 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |