C13H19ClN2O — CID 116745761
4-chloro-2-(1-methoxy-4,4-dimethylcyclohexyl)pyrimidine (PubChem CID 116745761) has the molecular formula C13H19ClN2O and a molecular weight of 254.76 g/mol. Its IUPAC name is 4-chloro-2-(1-methoxy-4,4-dimethylcyclohexyl)pyrimidine.
| Compound Name | 4-chloro-2-(1-methoxy-4,4-dimethylcyclohexyl)pyrimidine |
|---|---|
| PubChem CID | 116745761 |
| Molecular Formula | C13H19ClN2O |
| Molecular Weight | 254.76 g/mol |
| Exact Mass | 254.12 |
| IUPAC Name | 4-chloro-2-(1-methoxy-4,4-dimethylcyclohexyl)pyrimidine |
| SMILES | COC1(c2nccc(Cl)n2)CCC(C)(C)CC1 |
| InChI | InChI=1S/C13H19ClN2O/c1-12(2)5-7-13(17-3,8-6-12)11-15-9-4-10(14)16-11/h4,9H,5-8H2,1-3H3 |
| InChIKey | GYEBRIAHDAHHEO-UHFFFAOYSA-N |
| XLogP | 3.57 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 254.76 |
| LogP ≤ 5 | 3.57 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |