About N'-(2-cyanopyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-3,4-difluorobenzohydrazide
N'-(2-cyanopyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-3,4-difluorobenzohydrazide (PubChem CID 11674609) has the molecular formula C17H17F2N5O
and a molecular weight of 345.35 g/mol. Its IUPAC name is N'-(2-cyanopyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-3,4-difluorobenzohydrazide.
Molecular Properties
| Compound Name | N'-(2-cyanopyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-3,4-difluorobenzohydrazide |
| PubChem CID | 11674609 |
| Molecular Formula | C17H17F2N5O |
| Molecular Weight | 345.35 g/mol |
| Exact Mass | 345.14 |
| IUPAC Name | N'-(2-cyanopyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-3,4-difluorobenzohydrazide |
| SMILES | CC(C)(C)CN(NC(=O)c1ccc(F)c(F)c1)c1ccnc(C#N)n1 |
| InChI | InChI=1S/C17H17F2N5O/c1-17(2,3)10-24(15-6-7-21-14(9-20)22-15)23-16(25)11-4-5-12(18)13(19)8-11/h4-8H,10H2,1-3H3,(H,23,25) |
| InChIKey | HSSDERKOALADBG-UHFFFAOYSA-N |
| XLogP | 2.82 |
| TPSA | 81.91 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 25 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 345.35 |
| LogP ≤ 5 | 2.82 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 5 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'Oxygen-nitrogen_single_bond', 'substructure': 'N/A'} |
|---|
Analyze N'-(2-cyanopyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-3,4-difluorobenzohydrazide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N'-(2-cyanopyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-3,4-difluorobenzohydrazide?
The IUPAC name of N'-(2-cyanopyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-3,4-difluorobenzohydrazide (CID 11674609) is N'-(2-cyanopyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-3,4-difluorobenzohydrazide.
What is the SMILES notation for N'-(2-cyanopyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-3,4-difluorobenzohydrazide?
The canonical SMILES for N'-(2-cyanopyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-3,4-difluorobenzohydrazide is CC(C)(C)CN(NC(=O)c1ccc(F)c(F)c1)c1ccnc(C#N)n1.
What is the InChIKey of N'-(2-cyanopyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-3,4-difluorobenzohydrazide?
The InChIKey is HSSDERKOALADBG-UHFFFAOYSA-N. The full InChI is InChI=1S/C17H17F2N5O/c1-17(2,3)10-24(15-6-7-21-14(9-20)22-15)23-16(25)11-4-5-12(18)13(19)8-11/h4-8H,10H2,1-3H3,(H,23,25).
What are the key properties of N'-(2-cyanopyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-3,4-difluorobenzohydrazide?
N'-(2-cyanopyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-3,4-difluorobenzohydrazide has a molecular weight of 345.35 g/mol, XLogP of 2.82, 4 rotatable bonds, 1 hydrogen bond donors, and 5 hydrogen bond acceptors.
Where does this data come from?
All data for N'-(2-cyanopyrimidin-4-yl)-N'-(2,2-dimethylpropyl)-3,4-difluorobenzohydrazide is sourced from PubChem (CID 11674609), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).