C10H10Br2N4 — CID 11674617
2,3-bis(bromomethyl)quinoxaline-6,7-diamine (PubChem CID 11674617) has the molecular formula C10H10Br2N4 and a molecular weight of 346.03 g/mol. Its IUPAC name is 2,3-bis(bromomethyl)quinoxaline-6,7-diamine.
| Compound Name | 2,3-bis(bromomethyl)quinoxaline-6,7-diamine |
|---|---|
| PubChem CID | 11674617 |
| Molecular Formula | C10H10Br2N4 |
| Molecular Weight | 346.03 g/mol |
| Exact Mass | 343.93 |
| IUPAC Name | 2,3-bis(bromomethyl)quinoxaline-6,7-diamine |
| SMILES | Nc1cc2nc(CBr)c(CBr)nc2cc1N |
| InChI | InChI=1S/C10H10Br2N4/c11-3-9-10(4-12)16-8-2-6(14)5(13)1-7(8)15-9/h1-2H,3-4,13-14H2 |
| InChIKey | SEXORUTVBSMZPD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 346.03 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|