About 2,3-bis(bromomethyl)quinoxaline-6,7-diamine
2,3-bis(bromomethyl)quinoxaline-6,7-diamine (PubChem CID 11674617) has the molecular formula C10H10Br2N4
and a molecular weight of 346.03 g/mol. Its IUPAC name is 2,3-bis(bromomethyl)quinoxaline-6,7-diamine.
Molecular Properties
| Compound Name | 2,3-bis(bromomethyl)quinoxaline-6,7-diamine |
| PubChem CID | 11674617 |
| Molecular Formula | C10H10Br2N4 |
| Molecular Weight | 346.03 g/mol |
| Exact Mass | 343.93 |
| IUPAC Name | 2,3-bis(bromomethyl)quinoxaline-6,7-diamine |
| SMILES | Nc1cc2nc(CBr)c(CBr)nc2cc1N |
| InChI | InChI=1S/C10H10Br2N4/c11-3-9-10(4-12)16-8-2-6(14)5(13)1-7(8)15-9/h1-2H,3-4,13-14H2 |
| InChIKey | SEXORUTVBSMZPD-UHFFFAOYSA-N |
| XLogP | 2.58 |
| TPSA | 77.82 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 16 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 346.03 |
| LogP ≤ 5 | 2.58 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |
Computed Properties (RDKit)
| Structural Alerts | {'alert_name': 'alkyl_halide', 'substructure': 'N/A'}, {'alert_name': 'aniline', 'substructure': 'N/A'} |
|---|
Analyze 2,3-bis(bromomethyl)quinoxaline-6,7-diamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2,3-bis(bromomethyl)quinoxaline-6,7-diamine?
The IUPAC name of 2,3-bis(bromomethyl)quinoxaline-6,7-diamine (CID 11674617) is 2,3-bis(bromomethyl)quinoxaline-6,7-diamine.
What is the SMILES notation for 2,3-bis(bromomethyl)quinoxaline-6,7-diamine?
The canonical SMILES for 2,3-bis(bromomethyl)quinoxaline-6,7-diamine is Nc1cc2nc(CBr)c(CBr)nc2cc1N.
What is the InChIKey of 2,3-bis(bromomethyl)quinoxaline-6,7-diamine?
The InChIKey is SEXORUTVBSMZPD-UHFFFAOYSA-N. The full InChI is InChI=1S/C10H10Br2N4/c11-3-9-10(4-12)16-8-2-6(14)5(13)1-7(8)15-9/h1-2H,3-4,13-14H2.
What are the key properties of 2,3-bis(bromomethyl)quinoxaline-6,7-diamine?
2,3-bis(bromomethyl)quinoxaline-6,7-diamine has a molecular weight of 346.03 g/mol, XLogP of 2.58, 2 rotatable bonds, 2 hydrogen bond donors, and 4 hydrogen bond acceptors.
Where does this data come from?
All data for 2,3-bis(bromomethyl)quinoxaline-6,7-diamine is sourced from PubChem (CID 11674617), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).