C16H22Cl2N2O — CID 116746440
4,6-dichloro-5-cyclopentyl-2-(1-methoxycyclohexyl)pyrimidine (PubChem CID 116746440) has the molecular formula C16H22Cl2N2O and a molecular weight of 329.27 g/mol. Its IUPAC name is 4,6-dichloro-5-cyclopentyl-2-(1-methoxycyclohexyl)pyrimidine.
| Compound Name | 4,6-dichloro-5-cyclopentyl-2-(1-methoxycyclohexyl)pyrimidine |
|---|---|
| PubChem CID | 116746440 |
| Molecular Formula | C16H22Cl2N2O |
| Molecular Weight | 329.27 g/mol |
| Exact Mass | 328.11 |
| IUPAC Name | 4,6-dichloro-5-cyclopentyl-2-(1-methoxycyclohexyl)pyrimidine |
| SMILES | COC1(c2nc(Cl)c(C3CCCC3)c(Cl)n2)CCCCC1 |
| InChI | InChI=1S/C16H22Cl2N2O/c1-21-16(9-5-2-6-10-16)15-19-13(17)12(14(18)20-15)11-7-3-4-8-11/h11H,2-10H2,1H3 |
| InChIKey | YKLMYVZKEQWCRI-UHFFFAOYSA-N |
| XLogP | 5.25 |
| TPSA | 35.01 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 21 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 329.27 |
| LogP ≤ 5 | 5.25 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |