C14H17F3O3 — CID 116746756
3-methoxy-3-methyl-1-[4-(trifluoromethoxy)phenyl]pentan-2-one (PubChem CID 116746756) has the molecular formula C14H17F3O3 and a molecular weight of 290.28 g/mol. Its IUPAC name is 3-methoxy-3-methyl-1-[4-(trifluoromethoxy)phenyl]pentan-2-one.
| Compound Name | 3-methoxy-3-methyl-1-[4-(trifluoromethoxy)phenyl]pentan-2-one |
|---|---|
| PubChem CID | 116746756 |
| Molecular Formula | C14H17F3O3 |
| Molecular Weight | 290.28 g/mol |
| Exact Mass | 290.11 |
| IUPAC Name | 3-methoxy-3-methyl-1-[4-(trifluoromethoxy)phenyl]pentan-2-one |
| SMILES | CCC(C)(OC)C(=O)Cc1ccc(OC(F)(F)F)cc1 |
| InChI | InChI=1S/C14H17F3O3/c1-4-13(2,19-3)12(18)9-10-5-7-11(8-6-10)20-14(15,16)17/h5-8H,4,9H2,1-3H3 |
| InChIKey | AEVDNGQQOBMODM-UHFFFAOYSA-N |
| XLogP | 3.51 |
| TPSA | 35.53 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 290.28 |
| LogP ≤ 5 | 3.51 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 3 |