About N-benzyl-N-[(2,4-dichlorophenyl)methyl]-1-[(3S)-pyrrolidin-3-yl]methanamine
N-benzyl-N-[(2,4-dichlorophenyl)methyl]-1-[(3S)-pyrrolidin-3-yl]methanamine (PubChem CID 11674680) has the molecular formula C19H22Cl2N2
and a molecular weight of 349.31 g/mol. Its IUPAC name is N-benzyl-N-[(2,4-dichlorophenyl)methyl]-1-[(3S)-pyrrolidin-3-yl]methanamine.
Molecular Properties
| Compound Name | N-benzyl-N-[(2,4-dichlorophenyl)methyl]-1-[(3S)-pyrrolidin-3-yl]methanamine |
| PubChem CID | 11674680 |
| Molecular Formula | C19H22Cl2N2 |
| Molecular Weight | 349.31 g/mol |
| Exact Mass | 348.12 |
| IUPAC Name | N-benzyl-N-[(2,4-dichlorophenyl)methyl]-1-[(3S)-pyrrolidin-3-yl]methanamine |
| SMILES | Clc1ccc(CN(Cc2ccccc2)C[C@H]2CCNC2)c(Cl)c1 |
| InChI | InChI=1S/C19H22Cl2N2/c20-18-7-6-17(19(21)10-18)14-23(13-16-8-9-22-11-16)12-15-4-2-1-3-5-15/h1-7,10,16,22H,8-9,11-14H2/t16-/m0/s1 |
| InChIKey | UZEGOKTWNBRRSY-INIZCTEOSA-N |
| XLogP | 4.61 |
| TPSA | 15.27 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 23 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 349.31 |
| LogP ≤ 5 | 4.61 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze N-benzyl-N-[(2,4-dichlorophenyl)methyl]-1-[(3S)-pyrrolidin-3-yl]methanamine with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-benzyl-N-[(2,4-dichlorophenyl)methyl]-1-[(3S)-pyrrolidin-3-yl]methanamine?
The IUPAC name of N-benzyl-N-[(2,4-dichlorophenyl)methyl]-1-[(3S)-pyrrolidin-3-yl]methanamine (CID 11674680) is N-benzyl-N-[(2,4-dichlorophenyl)methyl]-1-[(3S)-pyrrolidin-3-yl]methanamine.
What is the SMILES notation for N-benzyl-N-[(2,4-dichlorophenyl)methyl]-1-[(3S)-pyrrolidin-3-yl]methanamine?
The canonical SMILES for N-benzyl-N-[(2,4-dichlorophenyl)methyl]-1-[(3S)-pyrrolidin-3-yl]methanamine is Clc1ccc(CN(Cc2ccccc2)C[C@H]2CCNC2)c(Cl)c1.
What is the InChIKey of N-benzyl-N-[(2,4-dichlorophenyl)methyl]-1-[(3S)-pyrrolidin-3-yl]methanamine?
The InChIKey is UZEGOKTWNBRRSY-INIZCTEOSA-N. The full InChI is InChI=1S/C19H22Cl2N2/c20-18-7-6-17(19(21)10-18)14-23(13-16-8-9-22-11-16)12-15-4-2-1-3-5-15/h1-7,10,16,22H,8-9,11-14H2/t16-/m0/s1.
What are the key properties of N-benzyl-N-[(2,4-dichlorophenyl)methyl]-1-[(3S)-pyrrolidin-3-yl]methanamine?
N-benzyl-N-[(2,4-dichlorophenyl)methyl]-1-[(3S)-pyrrolidin-3-yl]methanamine has a molecular weight of 349.31 g/mol, XLogP of 4.61, 6 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for N-benzyl-N-[(2,4-dichlorophenyl)methyl]-1-[(3S)-pyrrolidin-3-yl]methanamine is sourced from PubChem (CID 11674680), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).