About 4-ethyl-4-methoxy-2,2-dimethylhexan-3-one
4-ethyl-4-methoxy-2,2-dimethylhexan-3-one (PubChem CID 116747534) has the molecular formula C11H22O2
and a molecular weight of 186.29 g/mol. Its IUPAC name is 4-ethyl-4-methoxy-2,2-dimethylhexan-3-one.
Molecular Properties
| Compound Name | 4-ethyl-4-methoxy-2,2-dimethylhexan-3-one |
| PubChem CID | 116747534 |
| Molecular Formula | C11H22O2 |
| Molecular Weight | 186.29 g/mol |
| Exact Mass | 186.16 |
| IUPAC Name | 4-ethyl-4-methoxy-2,2-dimethylhexan-3-one |
| SMILES | CCC(CC)(OC)C(=O)C(C)(C)C |
| InChI | InChI=1S/C11H22O2/c1-7-11(8-2,13-6)9(12)10(3,4)5/h7-8H2,1-6H3 |
| InChIKey | XNFIAQVPKFAUEF-UHFFFAOYSA-N |
| XLogP | 2.81 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 13 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 186.29 |
| LogP ≤ 5 | 2.81 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 4-ethyl-4-methoxy-2,2-dimethylhexan-3-one with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 4-ethyl-4-methoxy-2,2-dimethylhexan-3-one?
The IUPAC name of 4-ethyl-4-methoxy-2,2-dimethylhexan-3-one (CID 116747534) is 4-ethyl-4-methoxy-2,2-dimethylhexan-3-one.
What is the SMILES notation for 4-ethyl-4-methoxy-2,2-dimethylhexan-3-one?
The canonical SMILES for 4-ethyl-4-methoxy-2,2-dimethylhexan-3-one is CCC(CC)(OC)C(=O)C(C)(C)C.
What is the InChIKey of 4-ethyl-4-methoxy-2,2-dimethylhexan-3-one?
The InChIKey is XNFIAQVPKFAUEF-UHFFFAOYSA-N. The full InChI is InChI=1S/C11H22O2/c1-7-11(8-2,13-6)9(12)10(3,4)5/h7-8H2,1-6H3.
What are the key properties of 4-ethyl-4-methoxy-2,2-dimethylhexan-3-one?
4-ethyl-4-methoxy-2,2-dimethylhexan-3-one has a molecular weight of 186.29 g/mol, XLogP of 2.81, 4 rotatable bonds, 0 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 4-ethyl-4-methoxy-2,2-dimethylhexan-3-one is sourced from PubChem (CID 116747534), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).