C25H33NO — CID 11674973
3-[(4aS,8aS)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenol (PubChem CID 11674973) has the molecular formula C25H33NO and a molecular weight of 363.55 g/mol. Its IUPAC name is 3-[(4aS,8aS)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenol.
| Compound Name | 3-[(4aS,8aS)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenol |
|---|---|
| PubChem CID | 11674973 |
| Molecular Formula | C25H33NO |
| Molecular Weight | 363.55 g/mol |
| Exact Mass | 363.26 |
| IUPAC Name | 3-[(4aS,8aS)-8a-methyl-2-(3-phenylpropyl)-3,4,5,6,7,8-hexahydro-1H-isoquinolin-4a-yl]phenol |
| SMILES | C[C@]12CCCC[C@@]1(c1cccc(O)c1)CCN(CCCc1ccccc1)C2 |
| InChI | InChI=1S/C25H33NO/c1-24-14-5-6-15-25(24,22-12-7-13-23(27)19-22)16-18-26(20-24)17-8-11-21-9-3-2-4-10-21/h2-4,7,9-10,12-13,19,27H,5-6,8,11,14-18,20H2,1H3/t24-,25+/m1/s1 |
| InChIKey | YVASRVQRZZSUCP-RPBOFIJWSA-N |
| XLogP | 5.55 |
| TPSA | 23.47 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 27 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 363.55 |
| LogP ≤ 5 | 5.55 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |