About 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)urea
1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)urea (PubChem CID 11675001) has the molecular formula C18H18Cl2N2O2
and a molecular weight of 365.26 g/mol. Its IUPAC name is 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)urea.
Molecular Properties
| Compound Name | 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)urea |
| PubChem CID | 11675001 |
| Molecular Formula | C18H18Cl2N2O2 |
| Molecular Weight | 365.26 g/mol |
| Exact Mass | 364.07 |
| IUPAC Name | 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)urea |
| SMILES | CC1(C)CC(NC(=O)Nc2ccc(Cl)cc2)c2cc(Cl)ccc2O1 |
| InChI | InChI=1S/C18H18Cl2N2O2/c1-18(2)10-15(14-9-12(20)5-8-16(14)24-18)22-17(23)21-13-6-3-11(19)4-7-13/h3-9,15H,10H2,1-2H3,(H2,21,22,23) |
| InChIKey | XCNTZWMMYVKZPH-UHFFFAOYSA-N |
| XLogP | 5.42 |
| TPSA | 50.36 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 24 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 365.26 |
| LogP ≤ 5 | 5.42 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)urea with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)urea?
The IUPAC name of 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)urea (CID 11675001) is 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)urea.
What is the SMILES notation for 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)urea?
The canonical SMILES for 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)urea is CC1(C)CC(NC(=O)Nc2ccc(Cl)cc2)c2cc(Cl)ccc2O1.
What is the InChIKey of 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)urea?
The InChIKey is XCNTZWMMYVKZPH-UHFFFAOYSA-N. The full InChI is InChI=1S/C18H18Cl2N2O2/c1-18(2)10-15(14-9-12(20)5-8-16(14)24-18)22-17(23)21-13-6-3-11(19)4-7-13/h3-9,15H,10H2,1-2H3,(H2,21,22,23).
What are the key properties of 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)urea?
1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)urea has a molecular weight of 365.26 g/mol, XLogP of 5.42, 2 rotatable bonds, 2 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(6-chloro-2,2-dimethyl-3,4-dihydrochromen-4-yl)-3-(4-chlorophenyl)urea is sourced from PubChem (CID 11675001), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).