C16H20Cl2O2 — CID 116750698
(3,4-dichlorophenyl)-(1-ethoxycycloheptyl)methanone (PubChem CID 116750698) has the molecular formula C16H20Cl2O2 and a molecular weight of 315.24 g/mol. Its IUPAC name is (3,4-dichlorophenyl)-(1-ethoxycycloheptyl)methanone.
| Compound Name | (3,4-dichlorophenyl)-(1-ethoxycycloheptyl)methanone |
|---|---|
| PubChem CID | 116750698 |
| Molecular Formula | C16H20Cl2O2 |
| Molecular Weight | 315.24 g/mol |
| Exact Mass | 314.08 |
| IUPAC Name | (3,4-dichlorophenyl)-(1-ethoxycycloheptyl)methanone |
| SMILES | CCOC1(C(=O)c2ccc(Cl)c(Cl)c2)CCCCCC1 |
| InChI | InChI=1S/C16H20Cl2O2/c1-2-20-16(9-5-3-4-6-10-16)15(19)12-7-8-13(17)14(18)11-12/h7-8,11H,2-6,9-10H2,1H3 |
| InChIKey | DRNNKJLONSVZTB-UHFFFAOYSA-N |
| XLogP | 5.31 |
| TPSA | 26.30 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 20 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 315.24 |
| LogP ≤ 5 | 5.31 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 2 |