C21H23NO5 — CID 11675075
(1S,2R,6S,7R,8S)-6,7-dihydroxy-1,2-bis(phenylmethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one (PubChem CID 11675075) has the molecular formula C21H23NO5 and a molecular weight of 369.42 g/mol. Its IUPAC name is (1S,2R,6S,7R,8S)-6,7-dihydroxy-1,2-bis(phenylmethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one.
| Compound Name | (1S,2R,6S,7R,8S)-6,7-dihydroxy-1,2-bis(phenylmethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
|---|---|
| PubChem CID | 11675075 |
| Molecular Formula | C21H23NO5 |
| Molecular Weight | 369.42 g/mol |
| Exact Mass | 369.16 |
| IUPAC Name | (1S,2R,6S,7R,8S)-6,7-dihydroxy-1,2-bis(phenylmethoxy)-1,2,5,6,7,8-hexahydropyrrolizin-3-one |
| SMILES | O=C1[C@H](OCc2ccccc2)[C@@H](OCc2ccccc2)[C@@H]2[C@@H](O)[C@@H](O)CN12 |
| InChI | InChI=1S/C21H23NO5/c23-16-11-22-17(18(16)24)19(26-12-14-7-3-1-4-8-14)20(21(22)25)27-13-15-9-5-2-6-10-15/h1-10,16-20,23-24H,11-13H2/t16-,17-,18-,19-,20+/m0/s1 |
| InChIKey | FMIFIAFUOAZUFC-VYJAJWGXSA-N |
| XLogP | 1.10 |
| TPSA | 79.23 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 369.42 |
| LogP ≤ 5 | 1.10 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 5 |