About 2-(2,2-dibromoethenyl)-N-(4-fluorophenyl)aniline
2-(2,2-dibromoethenyl)-N-(4-fluorophenyl)aniline (PubChem CID 11675116) has the molecular formula C14H10Br2FN
and a molecular weight of 371.05 g/mol. Its IUPAC name is 2-(2,2-dibromoethenyl)-N-(4-fluorophenyl)aniline.
Molecular Properties
| Compound Name | 2-(2,2-dibromoethenyl)-N-(4-fluorophenyl)aniline |
| PubChem CID | 11675116 |
| Molecular Formula | C14H10Br2FN |
| Molecular Weight | 371.05 g/mol |
| Exact Mass | 368.92 |
| IUPAC Name | 2-(2,2-dibromoethenyl)-N-(4-fluorophenyl)aniline |
| SMILES | Fc1ccc(Nc2ccccc2C=C(Br)Br)cc1 |
| InChI | InChI=1S/C14H10Br2FN/c15-14(16)9-10-3-1-2-4-13(10)18-12-7-5-11(17)6-8-12/h1-9,18H |
| InChIKey | VHAASUMSJRGZNT-UHFFFAOYSA-N |
| XLogP | 5.66 |
| TPSA | 12.03 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Lipinski Rule of Five
1 violation
| Rule | Value |
| MW ≤ 500 | 371.05 |
| LogP ≤ 5 | 5.66 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 1 |
Analyze 2-(2,2-dibromoethenyl)-N-(4-fluorophenyl)aniline with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 2-(2,2-dibromoethenyl)-N-(4-fluorophenyl)aniline?
The IUPAC name of 2-(2,2-dibromoethenyl)-N-(4-fluorophenyl)aniline (CID 11675116) is 2-(2,2-dibromoethenyl)-N-(4-fluorophenyl)aniline.
What is the SMILES notation for 2-(2,2-dibromoethenyl)-N-(4-fluorophenyl)aniline?
The canonical SMILES for 2-(2,2-dibromoethenyl)-N-(4-fluorophenyl)aniline is Fc1ccc(Nc2ccccc2C=C(Br)Br)cc1.
What is the InChIKey of 2-(2,2-dibromoethenyl)-N-(4-fluorophenyl)aniline?
The InChIKey is VHAASUMSJRGZNT-UHFFFAOYSA-N. The full InChI is InChI=1S/C14H10Br2FN/c15-14(16)9-10-3-1-2-4-13(10)18-12-7-5-11(17)6-8-12/h1-9,18H.
What are the key properties of 2-(2,2-dibromoethenyl)-N-(4-fluorophenyl)aniline?
2-(2,2-dibromoethenyl)-N-(4-fluorophenyl)aniline has a molecular weight of 371.05 g/mol, XLogP of 5.66, 3 rotatable bonds, 1 hydrogen bond donors, and 1 hydrogen bond acceptors.
Where does this data come from?
All data for 2-(2,2-dibromoethenyl)-N-(4-fluorophenyl)aniline is sourced from PubChem (CID 11675116), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).