C20H18F2N2O3 — CID 11675139
[(11R,12R)-10,10-difluoro-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-yl] acetate (PubChem CID 11675139) has the molecular formula C20H18F2N2O3 and a molecular weight of 372.37 g/mol. Its IUPAC name is [(11R,12R)-10,10-difluoro-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-yl] acetate.
| Compound Name | [(11R,12R)-10,10-difluoro-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-yl] acetate |
|---|---|
| PubChem CID | 11675139 |
| Molecular Formula | C20H18F2N2O3 |
| Molecular Weight | 372.37 g/mol |
| Exact Mass | 372.13 |
| IUPAC Name | [(11R,12R)-10,10-difluoro-4,5-dimethyl-12-phenyl-13-oxa-3,6-diazatricyclo[7.4.0.02,6]trideca-1(9),2,4,7-tetraen-11-yl] acetate |
| SMILES | CC(=O)O[C@@H]1[C@@H](c2ccccc2)Oc2c(ccn3c(C)c(C)nc23)C1(F)F |
| InChI | InChI=1S/C20H18F2N2O3/c1-11-12(2)24-10-9-15-17(19(24)23-11)27-16(14-7-5-4-6-8-14)18(20(15,21)22)26-13(3)25/h4-10,16,18H,1-3H3/t16-,18-/m1/s1 |
| InChIKey | VGPKGPCOEOUBHH-SJLPKXTDSA-N |
| XLogP | 4.11 |
| TPSA | 52.83 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 5 |
| Rotatable Bonds | 2 |
| Heavy Atoms | 27 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 372.37 |
| LogP ≤ 5 | 4.11 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 5 |