C27H44O — CID 11675386
(3aS,3bS,5aR,6R,8aS,8bS,10aS)-3a,5a-dimethyl-6-[(2R)-6-methylheptan-2-yl]-1,3b,4,5,6,7,8,8a,8b,9,10,10a-dodecahydroindeno[6,7-e]indene-3-carbaldehyde (PubChem CID 11675386) has the molecular formula C27H44O and a molecular weight of 384.65 g/mol. Its IUPAC name is (3aS,3bS,5aR,6R,8aS,8bS,10aS)-3a,5a-dimethyl-6-[(2R)-6-methylheptan-2-yl]-1,3b,4,5,6,7,8,8a,8b,9,10,10a-dodecahydroindeno[6,7-e]indene-3-carbaldehyde.
| Compound Name | (3aS,3bS,5aR,6R,8aS,8bS,10aS)-3a,5a-dimethyl-6-[(2R)-6-methylheptan-2-yl]-1,3b,4,5,6,7,8,8a,8b,9,10,10a-dodecahydroindeno[6,7-e]indene-3-carbaldehyde |
|---|---|
| PubChem CID | 11675386 |
| Molecular Formula | C27H44O |
| Molecular Weight | 384.65 g/mol |
| Exact Mass | 384.34 |
| IUPAC Name | (3aS,3bS,5aR,6R,8aS,8bS,10aS)-3a,5a-dimethyl-6-[(2R)-6-methylheptan-2-yl]-1,3b,4,5,6,7,8,8a,8b,9,10,10a-dodecahydroindeno[6,7-e]indene-3-carbaldehyde |
| SMILES | CC(C)CCC[C@@H](C)[C@H]1CC[C@H]2[C@@H]3CC[C@H]4CC=C(C=O)[C@]4(C)[C@H]3CC[C@]12C |
| InChI | InChI=1S/C27H44O/c1-18(2)7-6-8-19(3)23-13-14-24-22-12-11-20-9-10-21(17-28)27(20,5)25(22)15-16-26(23,24)4/h10,17-20,22-25H,6-9,11-16H2,1-5H3/t19-,20-,22+,23-,24+,25+,26-,27-/m1/s1 |
| InChIKey | RXBKAGCZSLEBAH-GYBXZDHJSA-N |
| XLogP | 7.45 |
| TPSA | 17.07 Ų |
| H-Bond Donors | |
| H-Bond Acceptors | 1 |
| Rotatable Bonds | 6 |
| Heavy Atoms | 28 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 384.65 |
| LogP ≤ 5 | 7.45 |
| H-Bond Donors ≤ 5 | 0 |
| H-Bond Acceptors ≤ 10 | 1 |
| Structural Alerts | {'alert_name': 'aldehyde', 'substructure': 'N/A'} |
|---|