C12H22O3 — CID 116754270
1-(4-ethoxyoxan-4-yl)-3-methylbut-3-en-1-ol (PubChem CID 116754270) has the molecular formula C12H22O3 and a molecular weight of 214.30 g/mol. Its IUPAC name is 1-(4-ethoxyoxan-4-yl)-3-methylbut-3-en-1-ol.
| Compound Name | 1-(4-ethoxyoxan-4-yl)-3-methylbut-3-en-1-ol |
|---|---|
| PubChem CID | 116754270 |
| Molecular Formula | C12H22O3 |
| Molecular Weight | 214.30 g/mol |
| Exact Mass | 214.16 |
| IUPAC Name | 1-(4-ethoxyoxan-4-yl)-3-methylbut-3-en-1-ol |
| SMILES | C=C(C)CC(O)C1(OCC)CCOCC1 |
| InChI | InChI=1S/C12H22O3/c1-4-15-12(5-7-14-8-6-12)11(13)9-10(2)3/h11,13H,2,4-9H2,1,3H3 |
| InChIKey | BFAOFCOFKLDBCQ-UHFFFAOYSA-N |
| XLogP | 1.90 |
| TPSA | 38.69 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 15 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 214.30 |
| LogP ≤ 5 | 1.90 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |
| Structural Alerts | {'alert_name': 'isolated_alkene', 'substructure': 'N/A'} |
|---|