About 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol
1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol (PubChem CID 116754445) has the molecular formula C15H30O2
and a molecular weight of 242.40 g/mol. Its IUPAC name is 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol.
Molecular Properties
| Compound Name | 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol |
| PubChem CID | 116754445 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol |
| SMILES | COC1(C(O)CCC(C)(C)C)CCC(C)CC1 |
| InChI | InChI=1S/C15H30O2/c1-12-6-10-15(17-5,11-7-12)13(16)8-9-14(2,3)4/h12-13,16H,6-11H2,1-5H3 |
| InChIKey | OQZPFPNEDRFFTG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |
Analyze 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol?
The IUPAC name of 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol (CID 116754445) is 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol.
What is the SMILES notation for 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol?
The canonical SMILES for 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol is COC1(C(O)CCC(C)(C)C)CCC(C)CC1.
What is the InChIKey of 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol?
The InChIKey is OQZPFPNEDRFFTG-UHFFFAOYSA-N. The full InChI is InChI=1S/C15H30O2/c1-12-6-10-15(17-5,11-7-12)13(16)8-9-14(2,3)4/h12-13,16H,6-11H2,1-5H3.
What are the key properties of 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol?
1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol has a molecular weight of 242.40 g/mol, XLogP of 3.77, 4 rotatable bonds, 1 hydrogen bond donors, and 2 hydrogen bond acceptors.
Where does this data come from?
All data for 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol is sourced from PubChem (CID 116754445), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).