C15H30O2 — CID 116754445
1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol (PubChem CID 116754445) has the molecular formula C15H30O2 and a molecular weight of 242.40 g/mol. Its IUPAC name is 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol.
| Compound Name | 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol |
|---|---|
| PubChem CID | 116754445 |
| Molecular Formula | C15H30O2 |
| Molecular Weight | 242.40 g/mol |
| Exact Mass | 242.22 |
| IUPAC Name | 1-(1-methoxy-4-methylcyclohexyl)-4,4-dimethylpentan-1-ol |
| SMILES | COC1(C(O)CCC(C)(C)C)CCC(C)CC1 |
| InChI | InChI=1S/C15H30O2/c1-12-6-10-15(17-5,11-7-12)13(16)8-9-14(2,3)4/h12-13,16H,6-11H2,1-5H3 |
| InChIKey | OQZPFPNEDRFFTG-UHFFFAOYSA-N |
| XLogP | 3.77 |
| TPSA | 29.46 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 17 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 242.40 |
| LogP ≤ 5 | 3.77 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |