C14H22N2O2 — CID 116756029
(4-amino-3-pyridinyl)-(1-methoxycycloheptyl)methanol (PubChem CID 116756029) has the molecular formula C14H22N2O2 and a molecular weight of 250.34 g/mol. Its IUPAC name is (4-amino-3-pyridinyl)-(1-methoxycycloheptyl)methanol.
| Compound Name | (4-amino-3-pyridinyl)-(1-methoxycycloheptyl)methanol |
|---|---|
| PubChem CID | 116756029 |
| Molecular Formula | C14H22N2O2 |
| Molecular Weight | 250.34 g/mol |
| Exact Mass | 250.17 |
| IUPAC Name | (4-amino-3-pyridinyl)-(1-methoxycycloheptyl)methanol |
| SMILES | COC1(C(O)c2cnccc2N)CCCCCC1 |
| InChI | InChI=1S/C14H22N2O2/c1-18-14(7-4-2-3-5-8-14)13(17)11-10-16-9-6-12(11)15/h6,9-10,13,17H,2-5,7-8H2,1H3,(H2,15,16) |
| InChIKey | TXNNDSNKQMLNPT-UHFFFAOYSA-N |
| XLogP | 2.44 |
| TPSA | 68.37 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 3 |
| Heavy Atoms | 18 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 250.34 |
| LogP ≤ 5 | 2.44 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 4 |