About N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(pyridazin-4-ylamino)benzamide
N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(pyridazin-4-ylamino)benzamide (PubChem CID 11675904) has the molecular formula C20H13F2N5OS
and a molecular weight of 409.42 g/mol. Its IUPAC name is N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(pyridazin-4-ylamino)benzamide.
Molecular Properties
| Compound Name | N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(pyridazin-4-ylamino)benzamide |
| PubChem CID | 11675904 |
| Molecular Formula | C20H13F2N5OS |
| Molecular Weight | 409.42 g/mol |
| Exact Mass | 409.08 |
| IUPAC Name | N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(pyridazin-4-ylamino)benzamide |
| SMILES | O=C(Nc1nc(-c2ccc(F)cc2F)cs1)c1ccc(Nc2ccnnc2)cc1 |
| InChI | InChI=1S/C20H13F2N5OS/c21-13-3-6-16(17(22)9-13)18-11-29-20(26-18)27-19(28)12-1-4-14(5-2-12)25-15-7-8-23-24-10-15/h1-11H,(H,23,25)(H,26,27,28) |
| InChIKey | SZEBSUJFKNNMDQ-UHFFFAOYSA-N |
| XLogP | 4.87 |
| TPSA | 79.80 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 29 |
| Complexity | — |
Lipinski Rule of Five
Passes Rule of Five
| Rule | Value |
| MW ≤ 500 | 409.42 |
| LogP ≤ 5 | 4.87 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
Analyze N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(pyridazin-4-ylamino)benzamide with MolForge
Explore ADMET properties, 3D molecular structure, drug-likeness score, and discover similar compounds using our AI-powered platform.
Launch Full Analysis
Frequently Asked Questions
What is the IUPAC name of N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(pyridazin-4-ylamino)benzamide?
The IUPAC name of N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(pyridazin-4-ylamino)benzamide (CID 11675904) is N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(pyridazin-4-ylamino)benzamide.
What is the SMILES notation for N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(pyridazin-4-ylamino)benzamide?
The canonical SMILES for N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(pyridazin-4-ylamino)benzamide is O=C(Nc1nc(-c2ccc(F)cc2F)cs1)c1ccc(Nc2ccnnc2)cc1.
What is the InChIKey of N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(pyridazin-4-ylamino)benzamide?
The InChIKey is SZEBSUJFKNNMDQ-UHFFFAOYSA-N. The full InChI is InChI=1S/C20H13F2N5OS/c21-13-3-6-16(17(22)9-13)18-11-29-20(26-18)27-19(28)12-1-4-14(5-2-12)25-15-7-8-23-24-10-15/h1-11H,(H,23,25)(H,26,27,28).
What are the key properties of N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(pyridazin-4-ylamino)benzamide?
N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(pyridazin-4-ylamino)benzamide has a molecular weight of 409.42 g/mol, XLogP of 4.87, 5 rotatable bonds, 2 hydrogen bond donors, and 6 hydrogen bond acceptors.
Where does this data come from?
All data for N-[4-(2,4-difluorophenyl)-1,3-thiazol-2-yl]-4-(pyridazin-4-ylamino)benzamide is sourced from PubChem (CID 11675904), the world's largest open chemistry database maintained by the National Library of Medicine (NIH).