C16H28N2O2 — CID 116760136
2-ethoxy-N,2-diethyl-1-(5-methoxy-3-pyridinyl)butan-1-amine (PubChem CID 116760136) has the molecular formula C16H28N2O2 and a molecular weight of 280.41 g/mol. Its IUPAC name is 2-ethoxy-N,2-diethyl-1-(5-methoxy-3-pyridinyl)butan-1-amine.
| Compound Name | 2-ethoxy-N,2-diethyl-1-(5-methoxy-3-pyridinyl)butan-1-amine |
|---|---|
| PubChem CID | 116760136 |
| Molecular Formula | C16H28N2O2 |
| Molecular Weight | 280.41 g/mol |
| Exact Mass | 280.22 |
| IUPAC Name | 2-ethoxy-N,2-diethyl-1-(5-methoxy-3-pyridinyl)butan-1-amine |
| SMILES | CCNC(c1cncc(OC)c1)C(CC)(CC)OCC |
| InChI | InChI=1S/C16H28N2O2/c1-6-16(7-2,20-9-4)15(18-8-3)13-10-14(19-5)12-17-11-13/h10-12,15,18H,6-9H2,1-5H3 |
| InChIKey | KKSJZCGSRAPRFQ-UHFFFAOYSA-N |
| XLogP | 3.34 |
| TPSA | 43.38 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 4 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 280.41 |
| LogP ≤ 5 | 3.34 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 4 |