C14H28F3NO — CID 116760339
5-ethoxy-5-ethyl-1,1,1-trifluoro-N-propylheptan-4-amine (PubChem CID 116760339) has the molecular formula C14H28F3NO and a molecular weight of 283.38 g/mol. Its IUPAC name is 5-ethoxy-5-ethyl-1,1,1-trifluoro-N-propylheptan-4-amine.
| Compound Name | 5-ethoxy-5-ethyl-1,1,1-trifluoro-N-propylheptan-4-amine |
|---|---|
| PubChem CID | 116760339 |
| Molecular Formula | C14H28F3NO |
| Molecular Weight | 283.38 g/mol |
| Exact Mass | 283.21 |
| IUPAC Name | 5-ethoxy-5-ethyl-1,1,1-trifluoro-N-propylheptan-4-amine |
| SMILES | CCCNC(CCC(F)(F)F)C(CC)(CC)OCC |
| InChI | InChI=1S/C14H28F3NO/c1-5-11-18-12(9-10-14(15,16)17)13(6-2,7-3)19-8-4/h12,18H,5-11H2,1-4H3 |
| InChIKey | AMCKJCXUGWNQMB-UHFFFAOYSA-N |
| XLogP | 4.29 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 10 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.38 |
| LogP ≤ 5 | 4.29 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |