C16H28N2O — CID 116760887
3-ethyl-1-(5-ethyl-2-pyridinyl)-3-methoxy-N-methylpentan-2-amine (PubChem CID 116760887) has the molecular formula C16H28N2O and a molecular weight of 264.41 g/mol. Its IUPAC name is 3-ethyl-1-(5-ethyl-2-pyridinyl)-3-methoxy-N-methylpentan-2-amine.
| Compound Name | 3-ethyl-1-(5-ethyl-2-pyridinyl)-3-methoxy-N-methylpentan-2-amine |
|---|---|
| PubChem CID | 116760887 |
| Molecular Formula | C16H28N2O |
| Molecular Weight | 264.41 g/mol |
| Exact Mass | 264.22 |
| IUPAC Name | 3-ethyl-1-(5-ethyl-2-pyridinyl)-3-methoxy-N-methylpentan-2-amine |
| SMILES | CCc1ccc(CC(NC)C(CC)(CC)OC)nc1 |
| InChI | InChI=1S/C16H28N2O/c1-6-13-9-10-14(18-12-13)11-15(17-4)16(7-2,8-3)19-5/h9-10,12,15,17H,6-8,11H2,1-5H3 |
| InChIKey | CBIKIVGKPCGXRV-UHFFFAOYSA-N |
| XLogP | 2.98 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 8 |
| Heavy Atoms | 19 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 264.41 |
| LogP ≤ 5 | 2.98 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |