C19H27NO — CID 116761218
N,2-diethyl-2-methoxy-1-naphthalen-2-ylbutan-1-amine (PubChem CID 116761218) has the molecular formula C19H27NO and a molecular weight of 285.43 g/mol. Its IUPAC name is N,2-diethyl-2-methoxy-1-naphthalen-2-ylbutan-1-amine.
| Compound Name | N,2-diethyl-2-methoxy-1-naphthalen-2-ylbutan-1-amine |
|---|---|
| PubChem CID | 116761218 |
| Molecular Formula | C19H27NO |
| Molecular Weight | 285.43 g/mol |
| Exact Mass | 285.21 |
| IUPAC Name | N,2-diethyl-2-methoxy-1-naphthalen-2-ylbutan-1-amine |
| SMILES | CCNC(c1ccc2ccccc2c1)C(CC)(CC)OC |
| InChI | InChI=1S/C19H27NO/c1-5-19(6-2,21-4)18(20-7-3)17-13-12-15-10-8-9-11-16(15)14-17/h8-14,18,20H,5-7H2,1-4H3 |
| InChIKey | DDMQGONLAMOVDX-UHFFFAOYSA-N |
| XLogP | 4.70 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 7 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 285.43 |
| LogP ≤ 5 | 4.70 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |