C18H37NO — CID 116761523
2-ethyl-1-(2-ethylcyclohexyl)-2-methoxy-N-propylbutan-1-amine (PubChem CID 116761523) has the molecular formula C18H37NO and a molecular weight of 283.50 g/mol. Its IUPAC name is 2-ethyl-1-(2-ethylcyclohexyl)-2-methoxy-N-propylbutan-1-amine.
| Compound Name | 2-ethyl-1-(2-ethylcyclohexyl)-2-methoxy-N-propylbutan-1-amine |
|---|---|
| PubChem CID | 116761523 |
| Molecular Formula | C18H37NO |
| Molecular Weight | 283.50 g/mol |
| Exact Mass | 283.29 |
| IUPAC Name | 2-ethyl-1-(2-ethylcyclohexyl)-2-methoxy-N-propylbutan-1-amine |
| SMILES | CCCNC(C1CCCCC1CC)C(CC)(CC)OC |
| InChI | InChI=1S/C18H37NO/c1-6-14-19-17(18(8-3,9-4)20-5)16-13-11-10-12-15(16)7-2/h15-17,19H,6-14H2,1-5H3 |
| InChIKey | DNKBDHXGNDUJPM-UHFFFAOYSA-N |
| XLogP | 4.78 |
| TPSA | 21.26 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 2 |
| Rotatable Bonds | 9 |
| Heavy Atoms | 20 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 283.50 |
| LogP ≤ 5 | 4.78 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 2 |