C18H24N2O — CID 116761616
1-(1-ethoxycyclopentyl)-2-quinolin-4-ylethanamine (PubChem CID 116761616) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-(1-ethoxycyclopentyl)-2-quinolin-4-ylethanamine.
| Compound Name | 1-(1-ethoxycyclopentyl)-2-quinolin-4-ylethanamine |
|---|---|
| PubChem CID | 116761616 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 1-(1-ethoxycyclopentyl)-2-quinolin-4-ylethanamine |
| SMILES | CCOC1(C(N)Cc2ccnc3ccccc23)CCCC1 |
| InChI | InChI=1S/C18H24N2O/c1-2-21-18(10-5-6-11-18)17(19)13-14-9-12-20-16-8-4-3-7-15(14)16/h3-4,7-9,12,17H,2,5-6,10-11,13,19H2,1H3 |
| InChIKey | KNVHJVHTAMPJNM-UHFFFAOYSA-N |
| XLogP | 3.45 |
| TPSA | 48.14 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.45 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |