C18H24N2O — CID 116761853
1-(1-ethoxycyclopentyl)-N-methyl-1-quinolin-3-ylmethanamine (PubChem CID 116761853) has the molecular formula C18H24N2O and a molecular weight of 284.40 g/mol. Its IUPAC name is 1-(1-ethoxycyclopentyl)-N-methyl-1-quinolin-3-ylmethanamine.
| Compound Name | 1-(1-ethoxycyclopentyl)-N-methyl-1-quinolin-3-ylmethanamine |
|---|---|
| PubChem CID | 116761853 |
| Molecular Formula | C18H24N2O |
| Molecular Weight | 284.40 g/mol |
| Exact Mass | 284.19 |
| IUPAC Name | 1-(1-ethoxycyclopentyl)-N-methyl-1-quinolin-3-ylmethanamine |
| SMILES | CCOC1(C(NC)c2cnc3ccccc3c2)CCCC1 |
| InChI | InChI=1S/C18H24N2O/c1-3-21-18(10-6-7-11-18)17(19-2)15-12-14-8-4-5-9-16(14)20-13-15/h4-5,8-9,12-13,17,19H,3,6-7,10-11H2,1-2H3 |
| InChIKey | MNUGEBXLBCNEPH-UHFFFAOYSA-N |
| XLogP | 3.84 |
| TPSA | 34.15 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 5 |
| Heavy Atoms | 21 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 284.40 |
| LogP ≤ 5 | 3.84 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |