C22H21N3O4S — CID 11676189
3-(7-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)-1-(2-cyclopropylethyl)quinoline-2,4-dione (PubChem CID 11676189) has the molecular formula C22H21N3O4S and a molecular weight of 423.49 g/mol. Its IUPAC name is 3-(7-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)-1-(2-cyclopropylethyl)quinoline-2,4-dione.
| Compound Name | 3-(7-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)-1-(2-cyclopropylethyl)quinoline-2,4-dione |
|---|---|
| PubChem CID | 11676189 |
| Molecular Formula | C22H21N3O4S |
| Molecular Weight | 423.49 g/mol |
| Exact Mass | 423.13 |
| IUPAC Name | 3-(7-amino-1,1-dioxo-4H-1λ6,4-benzothiazin-3-yl)-1-(2-cyclopropylethyl)quinoline-2,4-dione |
| SMILES | Nc1ccc2c(c1)S(=O)(=O)C=C(C1C(=O)c3ccccc3N(CCC3CC3)C1=O)N2 |
| InChI | InChI=1S/C22H21N3O4S/c23-14-7-8-16-19(11-14)30(28,29)12-17(24-16)20-21(26)15-3-1-2-4-18(15)25(22(20)27)10-9-13-5-6-13/h1-4,7-8,11-13,20,24H,5-6,9-10,23H2 |
| InChIKey | FKHAPPSNCQOFSN-UHFFFAOYSA-N |
| XLogP | 2.96 |
| TPSA | 109.57 Ų |
| H-Bond Donors | 2 |
| H-Bond Acceptors | 6 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 30 |
| Complexity | — |
Passes Rule of Five
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.49 |
| LogP ≤ 5 | 2.96 |
| H-Bond Donors ≤ 5 | 2 |
| H-Bond Acceptors ≤ 10 | 6 |
| Structural Alerts | {'alert_name': 'aniline', 'substructure': 'N/A'}, {'alert_name': 'beta-keto/anhydride', 'substructure': 'N/A'} |
|---|