C26H34FN3O — CID 11676194
7-ethyl-1-(4-fluorophenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide (PubChem CID 11676194) has the molecular formula C26H34FN3O and a molecular weight of 423.58 g/mol. Its IUPAC name is 7-ethyl-1-(4-fluorophenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide.
| Compound Name | 7-ethyl-1-(4-fluorophenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
|---|---|
| PubChem CID | 11676194 |
| Molecular Formula | C26H34FN3O |
| Molecular Weight | 423.58 g/mol |
| Exact Mass | 423.27 |
| IUPAC Name | 7-ethyl-1-(4-fluorophenyl)-N-(1,3,3-trimethyl-2-bicyclo[2.2.1]heptanyl)-4,5,6,7-tetrahydroindazole-3-carboxamide |
| SMILES | CCC1CCCc2c(C(=O)NC3C4(C)CCC(C4)C3(C)C)nn(-c3ccc(F)cc3)c21 |
| InChI | InChI=1S/C26H34FN3O/c1-5-16-7-6-8-20-21(29-30(22(16)20)19-11-9-18(27)10-12-19)23(31)28-24-25(2,3)17-13-14-26(24,4)15-17/h9-12,16-17,24H,5-8,13-15H2,1-4H3,(H,28,31) |
| InChIKey | CLXBLXPQQYSCKJ-UHFFFAOYSA-N |
| XLogP | 5.79 |
| TPSA | 46.92 Ų |
| H-Bond Donors | 1 |
| H-Bond Acceptors | 3 |
| Rotatable Bonds | 4 |
| Heavy Atoms | 31 |
| Complexity | — |
1 violation
| Rule | Value |
|---|---|
| MW ≤ 500 | 423.58 |
| LogP ≤ 5 | 5.79 |
| H-Bond Donors ≤ 5 | 1 |
| H-Bond Acceptors ≤ 10 | 3 |